C25H27FN4O4 — CID 95086548
ethyl (3S)-3-[(8-fluoro-2-morpholin-4-ylquinolin-6-yl)carbamoylamino]-3-phenylpropanoate (PubChem CID 95086548) has the molecular formula C25H27FN4O4 and a molecular weight of 466.51 g/mol. Its IUPAC name is ethyl (3S)-3-[(8-fluoro-2-morpholin-4-ylquinolin-6-yl)carbamoylamino]-3-phenylpropanoate.
| Compound Name | ethyl (3S)-3-[(8-fluoro-2-morpholin-4-ylquinolin-6-yl)carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 95086548 |
| Molecular Formula | C25H27FN4O4 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | ethyl (3S)-3-[(8-fluoro-2-morpholin-4-ylquinolin-6-yl)carbamoylamino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C[C@H](NC(=O)Nc1cc(F)c2nc(N3CCOCC3)ccc2c1)c1ccccc1 |
| InChI | InChI=1S/C25H27FN4O4/c1-2-34-23(31)16-21(17-6-4-3-5-7-17)28-25(32)27-19-14-18-8-9-22(29-24(18)20(26)15-19)30-10-12-33-13-11-30/h3-9,14-15,21H,2,10-13,16H2,1H3,(H2,27,28,32)/t21-/m0/s1 |
| InChIKey | JGTVNUNOZSAHPB-NRFANRHFSA-N |
| XLogP | 4.03 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |