C20H18BrFN4O2 — CID 53110812
1-(2-bromophenyl)-3-(8-fluoro-2-morpholin-4-ylquinolin-6-yl)urea (PubChem CID 53110812) has the molecular formula C20H18BrFN4O2 and a molecular weight of 445.29 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-(8-fluoro-2-morpholin-4-ylquinolin-6-yl)urea.
| Compound Name | 1-(2-bromophenyl)-3-(8-fluoro-2-morpholin-4-ylquinolin-6-yl)urea |
|---|---|
| PubChem CID | 53110812 |
| Molecular Formula | C20H18BrFN4O2 |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 1-(2-bromophenyl)-3-(8-fluoro-2-morpholin-4-ylquinolin-6-yl)urea |
| SMILES | O=C(Nc1cc(F)c2nc(N3CCOCC3)ccc2c1)Nc1ccccc1Br |
| InChI | InChI=1S/C20H18BrFN4O2/c21-15-3-1-2-4-17(15)24-20(27)23-14-11-13-5-6-18(25-19(13)16(22)12-14)26-7-9-28-10-8-26/h1-6,11-12H,7-10H2,(H2,23,24,27) |
| InChIKey | HRBUIGPWCYDPKK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |