C20H18ClFN4O — CID 53110693
1-(4-chlorophenyl)-3-(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)urea (PubChem CID 53110693) has the molecular formula C20H18ClFN4O and a molecular weight of 384.84 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)urea |
|---|---|
| PubChem CID | 53110693 |
| Molecular Formula | C20H18ClFN4O |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(8-fluoro-2-pyrrolidin-1-ylquinolin-6-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cc(F)c2nc(N3CCCC3)ccc2c1 |
| InChI | InChI=1S/C20H18ClFN4O/c21-14-4-6-15(7-5-14)23-20(27)24-16-11-13-3-8-18(26-9-1-2-10-26)25-19(13)17(22)12-16/h3-8,11-12H,1-2,9-10H2,(H2,23,24,27) |
| InChIKey | KIPHPVQCYASBHO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |