C22H27N5O — CID 68875408
N-(3-tert-butylphenyl)-2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]acetamide (PubChem CID 68875408) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(3-tert-butylphenyl)-2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-tert-butylphenyl)-2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 68875408 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | N-(3-tert-butylphenyl)-2-[4-(3-cyano-2-pyridinyl)piperazin-1-yl]acetamide |
| SMILES | CC(C)(C)c1cccc(NC(=O)CN2CCN(c3ncccc3C#N)CC2)c1 |
| InChI | InChI=1S/C22H27N5O/c1-22(2,3)18-7-4-8-19(14-18)25-20(28)16-26-10-12-27(13-11-26)21-17(15-23)6-5-9-24-21/h4-9,14H,10-13,16H2,1-3H3,(H,25,28) |
| InChIKey | TWQLJZRWEXRCOD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |