C15H18N2O2S2 — CID 167755284
N-[dimethyl(oxo)-λ6-sulfanylidene]-3-[(5-methylthiophen-2-yl)methylamino]benzamide (PubChem CID 167755284) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.46 g/mol. Its IUPAC name is N-[dimethyl(oxo)-λ6-sulfanylidene]-3-[(5-methylthiophen-2-yl)methylamino]benzamide.
| Compound Name | N-[dimethyl(oxo)-λ6-sulfanylidene]-3-[(5-methylthiophen-2-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 167755284 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-[dimethyl(oxo)-λ6-sulfanylidene]-3-[(5-methylthiophen-2-yl)methylamino]benzamide |
| SMILES | Cc1ccc(CNc2cccc(C(=O)N=S(C)(C)=O)c2)s1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-11-7-8-14(20-11)10-16-13-6-4-5-12(9-13)15(18)17-21(2,3)19/h4-9,16H,10H2,1-3H3 |
| InChIKey | MYIJZRARHGSYRC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |