C24H27N3O3S2 — CID 26232184
N-cyclopentyl-3-[(5-methylthiophen-2-yl)methylamino]-5-(phenylsulfamoyl)benzamide (PubChem CID 26232184) has the molecular formula C24H27N3O3S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is N-cyclopentyl-3-[(5-methylthiophen-2-yl)methylamino]-5-(phenylsulfamoyl)benzamide.
| Compound Name | N-cyclopentyl-3-[(5-methylthiophen-2-yl)methylamino]-5-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26232184 |
| Molecular Formula | C24H27N3O3S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-cyclopentyl-3-[(5-methylthiophen-2-yl)methylamino]-5-(phenylsulfamoyl)benzamide |
| SMILES | Cc1ccc(CNc2cc(C(=O)NC3CCCC3)cc(S(=O)(=O)Nc3ccccc3)c2)s1 |
| InChI | InChI=1S/C24H27N3O3S2/c1-17-11-12-22(31-17)16-25-21-13-18(24(28)26-19-7-5-6-8-19)14-23(15-21)32(29,30)27-20-9-3-2-4-10-20/h2-4,9-15,19,25,27H,5-8,16H2,1H3,(H,26,28) |
| InChIKey | LFTSBRUGYAHWDJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |