C18H21N3O6S — CID 26225543
methyl 2-[[3-(2-hydroxyethylamino)-5-(phenylsulfamoyl)benzoyl]amino]acetate (PubChem CID 26225543) has the molecular formula C18H21N3O6S and a molecular weight of 407.45 g/mol. Its IUPAC name is methyl 2-[[3-(2-hydroxyethylamino)-5-(phenylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | methyl 2-[[3-(2-hydroxyethylamino)-5-(phenylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 26225543 |
| Molecular Formula | C18H21N3O6S |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | methyl 2-[[3-(2-hydroxyethylamino)-5-(phenylsulfamoyl)benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cc(NCCO)cc(S(=O)(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C18H21N3O6S/c1-27-17(23)12-20-18(24)13-9-15(19-7-8-22)11-16(10-13)28(25,26)21-14-5-3-2-4-6-14/h2-6,9-11,19,21-22H,7-8,12H2,1H3,(H,20,24) |
| InChIKey | LBVSZYIMWUTIAQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |