C23H27N5O3S — CID 26227433
3-(3-methylbut-2-enylamino)-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-5-(phenylsulfamoyl)benzamide (PubChem CID 26227433) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is 3-(3-methylbut-2-enylamino)-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-5-(phenylsulfamoyl)benzamide.
| Compound Name | 3-(3-methylbut-2-enylamino)-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-5-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26227433 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 3-(3-methylbut-2-enylamino)-N-[(5-methyl-1H-pyrazol-3-yl)methyl]-5-(phenylsulfamoyl)benzamide |
| SMILES | CC(C)=CCNc1cc(C(=O)NCc2cc(C)[nH]n2)cc(S(=O)(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C23H27N5O3S/c1-16(2)9-10-24-20-12-18(23(29)25-15-21-11-17(3)26-27-21)13-22(14-20)32(30,31)28-19-7-5-4-6-8-19/h4-9,11-14,24,28H,10,15H2,1-3H3,(H,25,29)(H,26,27) |
| InChIKey | OCOIBFAHSXBUIZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|