C19H16F5N3O2S — CID 167756159
N-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methyl]-5-phenylmethoxypyrazine-2-carboxamide (PubChem CID 167756159) has the molecular formula C19H16F5N3O2S and a molecular weight of 445.41 g/mol. Its IUPAC name is N-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methyl]-5-phenylmethoxypyrazine-2-carboxamide.
| Compound Name | N-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methyl]-5-phenylmethoxypyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167756159 |
| Molecular Formula | C19H16F5N3O2S |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-[[4-(pentafluoro-λ6-sulfanyl)phenyl]methyl]-5-phenylmethoxypyrazine-2-carboxamide |
| SMILES | O=C(NCc1ccc(S(F)(F)(F)(F)F)cc1)c1cnc(OCc2ccccc2)cn1 |
| InChI | InChI=1S/C19H16F5N3O2S/c20-30(21,22,23,24)16-8-6-14(7-9-16)10-27-19(28)17-11-26-18(12-25-17)29-13-15-4-2-1-3-5-15/h1-9,11-12H,10,13H2,(H,27,28) |
| InChIKey | DQCCNDFBCVNJMI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |