C22H20F3N3O2 — CID 155956166
5-phenylmethoxy-N-[2-[4-(trifluoromethyl)phenyl]propan-2-yl]pyrazine-2-carboxamide (PubChem CID 155956166) has the molecular formula C22H20F3N3O2 and a molecular weight of 415.42 g/mol. Its IUPAC name is 5-phenylmethoxy-N-[2-[4-(trifluoromethyl)phenyl]propan-2-yl]pyrazine-2-carboxamide.
| Compound Name | 5-phenylmethoxy-N-[2-[4-(trifluoromethyl)phenyl]propan-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 155956166 |
| Molecular Formula | C22H20F3N3O2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 5-phenylmethoxy-N-[2-[4-(trifluoromethyl)phenyl]propan-2-yl]pyrazine-2-carboxamide |
| SMILES | CC(C)(NC(=O)c1cnc(OCc2ccccc2)cn1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H20F3N3O2/c1-21(2,16-8-10-17(11-9-16)22(23,24)25)28-20(29)18-12-27-19(13-26-18)30-14-15-6-4-3-5-7-15/h3-13H,14H2,1-2H3,(H,28,29) |
| InChIKey | SDZKRFDDBFXOKG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |