C21H18F3N3O2S — CID 155962292
5-phenylmethoxy-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]pyrazine-2-carboxamide (PubChem CID 155962292) has the molecular formula C21H18F3N3O2S and a molecular weight of 433.46 g/mol. Its IUPAC name is 5-phenylmethoxy-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]pyrazine-2-carboxamide.
| Compound Name | 5-phenylmethoxy-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 155962292 |
| Molecular Formula | C21H18F3N3O2S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 5-phenylmethoxy-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]pyrazine-2-carboxamide |
| SMILES | CC(NC(=O)c1cnc(OCc2ccccc2)cn1)c1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F3N3O2S/c1-14(16-8-5-9-17(10-16)30-21(22,23)24)27-20(28)18-11-26-19(12-25-18)29-13-15-6-3-2-4-7-15/h2-12,14H,13H2,1H3,(H,27,28) |
| InChIKey | UGTFOMUPWPLACR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |