C13H18F3NOS2 — CID 67510383
(S)-2-methyl-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]propane-2-sulfinamide (PubChem CID 67510383) has the molecular formula C13H18F3NOS2 and a molecular weight of 325.42 g/mol. Its IUPAC name is (S)-2-methyl-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]propane-2-sulfinamide.
| Compound Name | (S)-2-methyl-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 67510383 |
| Molecular Formula | C13H18F3NOS2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | (S)-2-methyl-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]propane-2-sulfinamide |
| SMILES | CC(N[S@@](=O)C(C)(C)C)c1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C13H18F3NOS2/c1-9(17-20(18)12(2,3)4)10-6-5-7-11(8-10)19-13(14,15)16/h5-9,17H,1-4H3/t9?,20-/m0/s1 |
| InChIKey | DVKAPCGQALVSSV-REVXXAFSSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |