C17H27NO3S — CID 76779879
tert-butyl 3-[1-(tert-butylsulfinylamino)ethyl]benzoate (PubChem CID 76779879) has the molecular formula C17H27NO3S and a molecular weight of 325.47 g/mol. Its IUPAC name is tert-butyl 3-[1-(tert-butylsulfinylamino)ethyl]benzoate.
| Compound Name | tert-butyl 3-[1-(tert-butylsulfinylamino)ethyl]benzoate |
|---|---|
| PubChem CID | 76779879 |
| Molecular Formula | C17H27NO3S |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | tert-butyl 3-[1-(tert-butylsulfinylamino)ethyl]benzoate |
| SMILES | CC(NS(=O)C(C)(C)C)c1cccc(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H27NO3S/c1-12(18-22(20)17(5,6)7)13-9-8-10-14(11-13)15(19)21-16(2,3)4/h8-12,18H,1-7H3 |
| InChIKey | XWWGXIIVFAMEJM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |