C19H31NO3S — CID 67395736
tert-butyl 3-[(1R)-1-[[(S)-tert-butylsulfinyl]amino]-2-methylpropyl]benzoate (PubChem CID 67395736) has the molecular formula C19H31NO3S and a molecular weight of 353.53 g/mol. Its IUPAC name is tert-butyl 3-[(1R)-1-[[(S)-tert-butylsulfinyl]amino]-2-methylpropyl]benzoate.
| Compound Name | tert-butyl 3-[(1R)-1-[[(S)-tert-butylsulfinyl]amino]-2-methylpropyl]benzoate |
|---|---|
| PubChem CID | 67395736 |
| Molecular Formula | C19H31NO3S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | tert-butyl 3-[(1R)-1-[[(S)-tert-butylsulfinyl]amino]-2-methylpropyl]benzoate |
| SMILES | CC(C)[C@@H](N[S@@](=O)C(C)(C)C)c1cccc(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H31NO3S/c1-13(2)16(20-24(22)19(6,7)8)14-10-9-11-15(12-14)17(21)23-18(3,4)5/h9-13,16,20H,1-8H3/t16-,24+/m1/s1 |
| InChIKey | GAJQYONWUUFZHO-GYCJOSAFSA-N |
| XLogP | 4.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |