C16H28N2O3S — CID 77277711
tert-butyl 5-[1-(tert-butylsulfinylamino)ethyl]-1-methylpyrrole-3-carboxylate (PubChem CID 77277711) has the molecular formula C16H28N2O3S and a molecular weight of 328.48 g/mol. Its IUPAC name is tert-butyl 5-[1-(tert-butylsulfinylamino)ethyl]-1-methylpyrrole-3-carboxylate.
| Compound Name | tert-butyl 5-[1-(tert-butylsulfinylamino)ethyl]-1-methylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 77277711 |
| Molecular Formula | C16H28N2O3S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | tert-butyl 5-[1-(tert-butylsulfinylamino)ethyl]-1-methylpyrrole-3-carboxylate |
| SMILES | CC(NS(=O)C(C)(C)C)c1cc(C(=O)OC(C)(C)C)cn1C |
| InChI | InChI=1S/C16H28N2O3S/c1-11(17-22(20)16(5,6)7)13-9-12(10-18(13)8)14(19)21-15(2,3)4/h9-11,17H,1-8H3 |
| InChIKey | XOILHSFFSZZJPE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |