C14H12F3N3OS — CID 159606767
N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]pyrimidine-4-carboxamide (PubChem CID 159606767) has the molecular formula C14H12F3N3OS and a molecular weight of 327.33 g/mol. Its IUPAC name is N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]pyrimidine-4-carboxamide.
| Compound Name | N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 159606767 |
| Molecular Formula | C14H12F3N3OS |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]pyrimidine-4-carboxamide |
| SMILES | CC(NC(=O)c1ccncn1)c1cccc(SC(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F3N3OS/c1-9(20-13(21)12-5-6-18-8-19-12)10-3-2-4-11(7-10)22-14(15,16)17/h2-9H,1H3,(H,20,21) |
| InChIKey | MMEFTSYMYNHTMN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |