C16H17F3N4O2S — CID 174811279
2-acetamido-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]-1H-pyrazine-2-carboxamide (PubChem CID 174811279) has the molecular formula C16H17F3N4O2S and a molecular weight of 386.40 g/mol. Its IUPAC name is 2-acetamido-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]-1H-pyrazine-2-carboxamide.
| Compound Name | 2-acetamido-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]-1H-pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 174811279 |
| Molecular Formula | C16H17F3N4O2S |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 2-acetamido-N-[1-[3-(trifluoromethylsulfanyl)phenyl]ethyl]-1H-pyrazine-2-carboxamide |
| SMILES | CC(=O)NC1(C(=O)NC(C)c2cccc(SC(F)(F)F)c2)C=NC=CN1 |
| InChI | InChI=1S/C16H17F3N4O2S/c1-10(12-4-3-5-13(8-12)26-16(17,18)19)22-14(25)15(23-11(2)24)9-20-6-7-21-15/h3-10,21H,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | YRFSVIJXOKGANC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |