C18H17N3O3 — CID 167756386
2-(oxan-3-yl)-5-(2-phenoxy-4-pyridinyl)-1,3,4-oxadiazole (PubChem CID 167756386) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-(oxan-3-yl)-5-(2-phenoxy-4-pyridinyl)-1,3,4-oxadiazole.
| Compound Name | 2-(oxan-3-yl)-5-(2-phenoxy-4-pyridinyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 167756386 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-(oxan-3-yl)-5-(2-phenoxy-4-pyridinyl)-1,3,4-oxadiazole |
| SMILES | c1ccc(Oc2cc(-c3nnc(C4CCCOC4)o3)ccn2)cc1 |
| InChI | InChI=1S/C18H17N3O3/c1-2-6-15(7-3-1)23-16-11-13(8-9-19-16)17-20-21-18(24-17)14-5-4-10-22-12-14/h1-3,6-9,11,14H,4-5,10,12H2 |
| InChIKey | AGWGJTLWMYPVPN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |