C28H25N3OS — CID 167756896
1-(4-phenylphenyl)-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylamino]ethanol (PubChem CID 167756896) has the molecular formula C28H25N3OS and a molecular weight of 451.60 g/mol. Its IUPAC name is 1-(4-phenylphenyl)-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylamino]ethanol.
| Compound Name | 1-(4-phenylphenyl)-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 167756896 |
| Molecular Formula | C28H25N3OS |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-(4-phenylphenyl)-2-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylamino]ethanol |
| SMILES | OC(CNCc1cn(-c2ccccc2)nc1-c1cccs1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25N3OS/c32-26(23-15-13-22(14-16-23)21-8-3-1-4-9-21)19-29-18-24-20-31(25-10-5-2-6-11-25)30-28(24)27-12-7-17-33-27/h1-17,20,26,29,32H,18-19H2 |
| InChIKey | PSVYXRFZAJKXJJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |