C16H14ClN5O — CID 167758081
6-chloro-4-N-[3-(pyridin-3-ylmethoxy)phenyl]pyrimidine-2,4-diamine (PubChem CID 167758081) has the molecular formula C16H14ClN5O and a molecular weight of 327.78 g/mol. Its IUPAC name is 6-chloro-4-N-[3-(pyridin-3-ylmethoxy)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[3-(pyridin-3-ylmethoxy)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 167758081 |
| Molecular Formula | C16H14ClN5O |
| Molecular Weight | 327.78 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 6-chloro-4-N-[3-(pyridin-3-ylmethoxy)phenyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Cl)cc(Nc2cccc(OCc3cccnc3)c2)n1 |
| InChI | InChI=1S/C16H14ClN5O/c17-14-8-15(22-16(18)21-14)20-12-4-1-5-13(7-12)23-10-11-3-2-6-19-9-11/h1-9H,10H2,(H3,18,20,21,22) |
| InChIKey | GMSAMCZKDNTTAM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |