C19H24FNO3S — CID 167759201
2-[[2-(4-tert-butylphenyl)sulfonylethylamino]methyl]-4-fluorophenol (PubChem CID 167759201) has the molecular formula C19H24FNO3S and a molecular weight of 365.47 g/mol. Its IUPAC name is 2-[[2-(4-tert-butylphenyl)sulfonylethylamino]methyl]-4-fluorophenol.
| Compound Name | 2-[[2-(4-tert-butylphenyl)sulfonylethylamino]methyl]-4-fluorophenol |
|---|---|
| PubChem CID | 167759201 |
| Molecular Formula | C19H24FNO3S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2-[[2-(4-tert-butylphenyl)sulfonylethylamino]methyl]-4-fluorophenol |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)CCNCc2cc(F)ccc2O)cc1 |
| InChI | InChI=1S/C19H24FNO3S/c1-19(2,3)15-4-7-17(8-5-15)25(23,24)11-10-21-13-14-12-16(20)6-9-18(14)22/h4-9,12,21-22H,10-11,13H2,1-3H3 |
| InChIKey | OOUCANXCCRCIRI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|