C18H22FNO2S — CID 3673716
4-tert-butyl-N-[(5-fluoro-2-methylphenyl)methyl]benzenesulfonamide (PubChem CID 3673716) has the molecular formula C18H22FNO2S and a molecular weight of 335.44 g/mol. Its IUPAC name is 4-tert-butyl-N-[(5-fluoro-2-methylphenyl)methyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[(5-fluoro-2-methylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3673716 |
| Molecular Formula | C18H22FNO2S |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-tert-butyl-N-[(5-fluoro-2-methylphenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(F)cc1CNS(=O)(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H22FNO2S/c1-13-5-8-16(19)11-14(13)12-20-23(21,22)17-9-6-15(7-10-17)18(2,3)4/h5-11,20H,12H2,1-4H3 |
| InChIKey | CMRXMCQTYSXPMY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |