C15H18ClNO2S — CID 142645086
N-[(2,5-dimethylphenyl)methyl]benzenesulfonamide;hydrochloride (PubChem CID 142645086) has the molecular formula C15H18ClNO2S and a molecular weight of 311.83 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)methyl]benzenesulfonamide;hydrochloride.
| Compound Name | N-[(2,5-dimethylphenyl)methyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 142645086 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-[(2,5-dimethylphenyl)methyl]benzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(C)c(CNS(=O)(=O)c2ccccc2)c1.Cl |
| InChI | InChI=1S/C15H17NO2S.ClH/c1-12-8-9-13(2)14(10-12)11-16-19(17,18)15-6-4-3-5-7-15;/h3-10,16H,11H2,1-2H3;1H |
| InChIKey | HJBCVYYDQHBFMJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |