C18H12N4O3 — CID 167762135
7-[(4-amino-1,3,5-triazin-2-yl)oxy]-4-phenylchromen-2-one (PubChem CID 167762135) has the molecular formula C18H12N4O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 7-[(4-amino-1,3,5-triazin-2-yl)oxy]-4-phenylchromen-2-one.
| Compound Name | 7-[(4-amino-1,3,5-triazin-2-yl)oxy]-4-phenylchromen-2-one |
|---|---|
| PubChem CID | 167762135 |
| Molecular Formula | C18H12N4O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 7-[(4-amino-1,3,5-triazin-2-yl)oxy]-4-phenylchromen-2-one |
| SMILES | Nc1ncnc(Oc2ccc3c(-c4ccccc4)cc(=O)oc3c2)n1 |
| InChI | InChI=1S/C18H12N4O3/c19-17-20-10-21-18(22-17)24-12-6-7-13-14(11-4-2-1-3-5-11)9-16(23)25-15(13)8-12/h1-10H,(H2,19,20,21,22) |
| InChIKey | RDJIEEZARBTAGX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 104.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|