About 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one
7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one (PubChem CID 4056109) has the molecular formula C22H15F3N2O5
and a molecular weight of 444.37 g/mol. Its IUPAC name is 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one.
Molecular Properties
| Compound Name | 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one |
| PubChem CID | 4056109 |
| Molecular Formula | C22H15F3N2O5 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one |
| SMILES | COc1cc(OC)nc(Oc2ccc3c(-c4cccc(C(F)(F)F)c4)cc(=O)oc3c2)n1 |
| InChI | InChI=1S/C22H15F3N2O5/c1-29-18-11-19(30-2)27-21(26-18)31-14-6-7-15-16(10-20(28)32-17(15)9-14)12-4-3-5-13(8-12)22(23,24)25/h3-11H,1-2H3 |
| InChIKey | AKWGLCZQBYKDOC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one?
The IUPAC name of 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one (CID 4056109) is 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one.
What is the SMILES notation for 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one?
The canonical SMILES for 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one is COc1cc(OC)nc(Oc2ccc3c(-c4cccc(C(F)(F)F)c4)cc(=O)oc3c2)n1.
What is the InChIKey of 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one?
The InChIKey is AKWGLCZQBYKDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F3N2O5/c1-29-18-11-19(30-2)27-21(26-18)31-14-6-7-15-16(10-20(28)32-17(15)9-14)12-4-3-5-13(8-12)22(23,24)25/h3-11H,1-2H3.
What are the key properties of 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one?
7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one has a molecular weight of 444.37 g/mol, XLogP of 5.08, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4,6-dimethoxypyrimidin-2-yl)oxy-4-[3-(trifluoromethyl)phenyl]chromen-2-one is sourced from PubChem (CID 4056109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).