C19H24N2 — CID 16776550
N-[1-(9H-fluoren-2-yl)ethyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 16776550) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is N-[1-(9H-fluoren-2-yl)ethyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[1-(9H-fluoren-2-yl)ethyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 16776550 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | N-[1-(9H-fluoren-2-yl)ethyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CC(NCCN(C)C)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C19H24N2/c1-14(20-10-11-21(2)3)15-8-9-19-17(12-15)13-16-6-4-5-7-18(16)19/h4-9,12,14,20H,10-11,13H2,1-3H3 |
| InChIKey | JRGLMYZAOYZYBI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |