C25H29BrN4O4S — CID 167766327
N-[2-[[5-bromo-3-[(6-methoxynaphthalen-2-yl)methyl-methylsulfamoyl]-2-pyridinyl]amino]ethyl]cyclobutanecarboxamide (PubChem CID 167766327) has the molecular formula C25H29BrN4O4S and a molecular weight of 561.50 g/mol. Its IUPAC name is N-[2-[[5-bromo-3-[(6-methoxynaphthalen-2-yl)methyl-methylsulfamoyl]-2-pyridinyl]amino]ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-[[5-bromo-3-[(6-methoxynaphthalen-2-yl)methyl-methylsulfamoyl]-2-pyridinyl]amino]ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 167766327 |
| Molecular Formula | C25H29BrN4O4S |
| Molecular Weight | 561.50 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | N-[2-[[5-bromo-3-[(6-methoxynaphthalen-2-yl)methyl-methylsulfamoyl]-2-pyridinyl]amino]ethyl]cyclobutanecarboxamide |
| SMILES | COc1ccc2cc(CN(C)S(=O)(=O)c3cc(Br)cnc3NCCNC(=O)C3CCC3)ccc2c1 |
| InChI | InChI=1S/C25H29BrN4O4S/c1-30(16-17-6-7-20-13-22(34-2)9-8-19(20)12-17)35(32,33)23-14-21(26)15-29-24(23)27-10-11-28-25(31)18-4-3-5-18/h6-9,12-15,18H,3-5,10-11,16H2,1-2H3,(H,27,29)(H,28,31) |
| InChIKey | LWKLBVWCOJBCKI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|