C19H27FN2O4S — CID 167769059
N-[(4-fluorophenyl)-(oxolan-2-yl)methyl]-4-methylsulfonylazepane-1-carboxamide (PubChem CID 167769059) has the molecular formula C19H27FN2O4S and a molecular weight of 398.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-(oxolan-2-yl)methyl]-4-methylsulfonylazepane-1-carboxamide.
| Compound Name | N-[(4-fluorophenyl)-(oxolan-2-yl)methyl]-4-methylsulfonylazepane-1-carboxamide |
|---|---|
| PubChem CID | 167769059 |
| Molecular Formula | C19H27FN2O4S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[(4-fluorophenyl)-(oxolan-2-yl)methyl]-4-methylsulfonylazepane-1-carboxamide |
| SMILES | CS(=O)(=O)C1CCCN(C(=O)NC(c2ccc(F)cc2)C2CCCO2)CC1 |
| InChI | InChI=1S/C19H27FN2O4S/c1-27(24,25)16-4-2-11-22(12-10-16)19(23)21-18(17-5-3-13-26-17)14-6-8-15(20)9-7-14/h6-9,16-18H,2-5,10-13H2,1H3,(H,21,23) |
| InChIKey | NSKXWROWFDJFIG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |