C21H30FN3O2 — CID 60547818
4-cyclopentyl-N-[(4-fluorophenyl)-(oxolan-2-yl)methyl]piperazine-1-carboxamide (PubChem CID 60547818) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is 4-cyclopentyl-N-[(4-fluorophenyl)-(oxolan-2-yl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-cyclopentyl-N-[(4-fluorophenyl)-(oxolan-2-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60547818 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 4-cyclopentyl-N-[(4-fluorophenyl)-(oxolan-2-yl)methyl]piperazine-1-carboxamide |
| SMILES | O=C(NC(c1ccc(F)cc1)C1CCCO1)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C21H30FN3O2/c22-17-9-7-16(8-10-17)20(19-6-3-15-27-19)23-21(26)25-13-11-24(12-14-25)18-4-1-2-5-18/h7-10,18-20H,1-6,11-15H2,(H,23,26) |
| InChIKey | WPBJTMBPDLFERQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |