C16H16FNO3 — CID 94633539
N-[(S)-(4-fluorophenyl)-[(2R)-oxolan-2-yl]methyl]furan-2-carboxamide (PubChem CID 94633539) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is N-[(S)-(4-fluorophenyl)-[(2R)-oxolan-2-yl]methyl]furan-2-carboxamide.
| Compound Name | N-[(S)-(4-fluorophenyl)-[(2R)-oxolan-2-yl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 94633539 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[(S)-(4-fluorophenyl)-[(2R)-oxolan-2-yl]methyl]furan-2-carboxamide |
| SMILES | O=C(N[C@@H](c1ccc(F)cc1)[C@H]1CCCO1)c1ccco1 |
| InChI | InChI=1S/C16H16FNO3/c17-12-7-5-11(6-8-12)15(13-3-1-9-20-13)18-16(19)14-4-2-10-21-14/h2,4-8,10,13,15H,1,3,9H2,(H,18,19)/t13-,15+/m1/s1 |
| InChIKey | UFKNXUQFIKSVHK-HIFRSBDPSA-N |
| XLogP | 3.07 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |