C22H21FN2O2 — CID 97018110
N-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]-4-pyrrol-1-ylbenzamide (PubChem CID 97018110) has the molecular formula C22H21FN2O2 and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]-4-pyrrol-1-ylbenzamide.
| Compound Name | N-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]-4-pyrrol-1-ylbenzamide |
|---|---|
| PubChem CID | 97018110 |
| Molecular Formula | C22H21FN2O2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]-4-pyrrol-1-ylbenzamide |
| SMILES | O=C(N[C@H](c1ccc(F)cc1)[C@@H]1CCCO1)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C22H21FN2O2/c23-18-9-5-16(6-10-18)21(20-4-3-15-27-20)24-22(26)17-7-11-19(12-8-17)25-13-1-2-14-25/h1-2,5-14,20-21H,3-4,15H2,(H,24,26)/t20-,21+/m0/s1 |
| InChIKey | RBKFBWIPBKVECV-LEWJYISDSA-N |
| XLogP | 4.27 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |