C21H27N5O2 — CID 167770268
[(2R)-4-(2-ethylbenzoyl)-2-methylpiperazin-1-yl]-[3-(triazol-1-yl)cyclobutyl]methanone (PubChem CID 167770268) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is [(2R)-4-(2-ethylbenzoyl)-2-methylpiperazin-1-yl]-[3-(triazol-1-yl)cyclobutyl]methanone.
| Compound Name | [(2R)-4-(2-ethylbenzoyl)-2-methylpiperazin-1-yl]-[3-(triazol-1-yl)cyclobutyl]methanone |
|---|---|
| PubChem CID | 167770268 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | [(2R)-4-(2-ethylbenzoyl)-2-methylpiperazin-1-yl]-[3-(triazol-1-yl)cyclobutyl]methanone |
| SMILES | CCc1ccccc1C(=O)N1CCN(C(=O)C2CC(n3ccnn3)C2)[C@H](C)C1 |
| InChI | InChI=1S/C21H27N5O2/c1-3-16-6-4-5-7-19(16)21(28)24-10-11-25(15(2)14-24)20(27)17-12-18(13-17)26-9-8-22-23-26/h4-9,15,17-18H,3,10-14H2,1-2H3/t15-,17?,18?/m1/s1 |
| InChIKey | FZIYSPBLJIQAAI-FAEJEUNOSA-N |
| XLogP | 2.16 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |