C24H22N4O3 — CID 167772605
N-[1-(2-morpholin-4-yl-2-oxoethyl)pyrazol-3-yl]anthracene-9-carboxamide (PubChem CID 167772605) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[1-(2-morpholin-4-yl-2-oxoethyl)pyrazol-3-yl]anthracene-9-carboxamide.
| Compound Name | N-[1-(2-morpholin-4-yl-2-oxoethyl)pyrazol-3-yl]anthracene-9-carboxamide |
|---|---|
| PubChem CID | 167772605 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N-[1-(2-morpholin-4-yl-2-oxoethyl)pyrazol-3-yl]anthracene-9-carboxamide |
| SMILES | O=C(Nc1ccn(CC(=O)N2CCOCC2)n1)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C24H22N4O3/c29-22(27-11-13-31-14-12-27)16-28-10-9-21(26-28)25-24(30)23-19-7-3-1-5-17(19)15-18-6-2-4-8-20(18)23/h1-10,15H,11-14,16H2,(H,25,26,30) |
| InChIKey | IWHHFPYMRVDILT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|