C12H14F2O3 — CID 167772945
4-[(2,6-difluorophenoxy)methyl]oxan-4-ol (PubChem CID 167772945) has the molecular formula C12H14F2O3 and a molecular weight of 244.24 g/mol. Its IUPAC name is 4-[(2,6-difluorophenoxy)methyl]oxan-4-ol.
| Compound Name | 4-[(2,6-difluorophenoxy)methyl]oxan-4-ol |
|---|---|
| PubChem CID | 167772945 |
| Molecular Formula | C12H14F2O3 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 4-[(2,6-difluorophenoxy)methyl]oxan-4-ol |
| SMILES | OC1(COc2c(F)cccc2F)CCOCC1 |
| InChI | InChI=1S/C12H14F2O3/c13-9-2-1-3-10(14)11(9)17-8-12(15)4-6-16-7-5-12/h1-3,15H,4-8H2 |
| InChIKey | NLMNJNRFAZXRKD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |