C15H17F2NO5 — CID 167776520
3-[[4-[4-(difluoromethoxy)phenyl]oxan-4-yl]amino]-3-oxopropanoic acid (PubChem CID 167776520) has the molecular formula C15H17F2NO5 and a molecular weight of 329.30 g/mol. Its IUPAC name is 3-[[4-[4-(difluoromethoxy)phenyl]oxan-4-yl]amino]-3-oxopropanoic acid.
| Compound Name | 3-[[4-[4-(difluoromethoxy)phenyl]oxan-4-yl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 167776520 |
| Molecular Formula | C15H17F2NO5 |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-[[4-[4-(difluoromethoxy)phenyl]oxan-4-yl]amino]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)NC1(c2ccc(OC(F)F)cc2)CCOCC1 |
| InChI | InChI=1S/C15H17F2NO5/c16-14(17)23-11-3-1-10(2-4-11)15(5-7-22-8-6-15)18-12(19)9-13(20)21/h1-4,14H,5-9H2,(H,18,19)(H,20,21) |
| InChIKey | MOQZYWFGTZKYGT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|