C24H28N6O5 — CID 167781074
N-(2,2-dimethyloxan-4-yl)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-methyltriazole-4-carboxamide (PubChem CID 167781074) has the molecular formula C24H28N6O5 and a molecular weight of 480.53 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-methyltriazole-4-carboxamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 167781074 |
| Molecular Formula | C24H28N6O5 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-1-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]-N-methyltriazole-4-carboxamide |
| SMILES | CN(C(=O)c1cn(-c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)nn1)C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C24H28N6O5/c1-24(2)11-16(8-9-35-24)28(3)23(34)18-13-30(27-26-18)15-5-4-14-12-29(22(33)17(14)10-15)19-6-7-20(31)25-21(19)32/h4-5,10,13,16,19H,6-9,11-12H2,1-3H3,(H,25,31,32) |
| InChIKey | JCCCCHSLHRKNLN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|