About 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one
5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 167783703) has the molecular formula C17H11Cl2N3OS
and a molecular weight of 376.27 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 167783703 |
| Molecular Formula | C17H11Cl2N3OS |
| Molecular Weight | 376.27 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(-c3cc[nH]c3)[nH]c(=O)c2c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl2N3OS/c1-8-13(11-3-2-10(18)6-12(11)19)14-16(23)21-15(22-17(14)24-8)9-4-5-20-7-9/h2-7,20H,1H3,(H,21,22,23) |
| InChIKey | FGIHNGVBPBGJKP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.27 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one (CID 167783703) is 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one is Cc1sc2nc(-c3cc[nH]c3)[nH]c(=O)c2c1-c1ccc(Cl)cc1Cl.
What is the InChIKey of 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one?
The InChIKey is FGIHNGVBPBGJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl2N3OS/c1-8-13(11-3-2-10(18)6-12(11)19)14-16(23)21-15(22-17(14)24-8)9-4-5-20-7-9/h2-7,20H,1H3,(H,21,22,23).
What are the key properties of 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one?
5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one has a molecular weight of 376.27 g/mol, XLogP of 5.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenyl)-6-methyl-2-(1H-pyrrol-3-yl)-3H-thieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 167783703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).