C25H27N5O4S — CID 167784135
6-[4-[4-[ethyl(phenyl)sulfamoyl]benzoyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 167784135) has the molecular formula C25H27N5O4S and a molecular weight of 493.59 g/mol. Its IUPAC name is 6-[4-[4-[ethyl(phenyl)sulfamoyl]benzoyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 6-[4-[4-[ethyl(phenyl)sulfamoyl]benzoyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167784135 |
| Molecular Formula | C25H27N5O4S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 6-[4-[4-[ethyl(phenyl)sulfamoyl]benzoyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)N2CCN(c3ccc(C(N)=O)cn3)CC2)cc1 |
| InChI | InChI=1S/C25H27N5O4S/c1-2-30(21-6-4-3-5-7-21)35(33,34)22-11-8-19(9-12-22)25(32)29-16-14-28(15-17-29)23-13-10-20(18-27-23)24(26)31/h3-13,18H,2,14-17H2,1H3,(H2,26,31) |
| InChIKey | OVSROTWWNCWGAS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 116.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |