C27H38N4O5S — CID 167787178
2-(diethylamino)ethyl 3-[[4-(3-pyrrolidin-1-ylpropylsulfamoyl)benzoyl]amino]benzoate (PubChem CID 167787178) has the molecular formula C27H38N4O5S and a molecular weight of 530.69 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-[[4-(3-pyrrolidin-1-ylpropylsulfamoyl)benzoyl]amino]benzoate.
| Compound Name | 2-(diethylamino)ethyl 3-[[4-(3-pyrrolidin-1-ylpropylsulfamoyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 167787178 |
| Molecular Formula | C27H38N4O5S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 2-(diethylamino)ethyl 3-[[4-(3-pyrrolidin-1-ylpropylsulfamoyl)benzoyl]amino]benzoate |
| SMILES | CCN(CC)CCOC(=O)c1cccc(NC(=O)c2ccc(S(=O)(=O)NCCCN3CCCC3)cc2)c1 |
| InChI | InChI=1S/C27H38N4O5S/c1-3-30(4-2)19-20-36-27(33)23-9-7-10-24(21-23)29-26(32)22-11-13-25(14-12-22)37(34,35)28-15-8-18-31-16-5-6-17-31/h7,9-14,21,28H,3-6,8,15-20H2,1-2H3,(H,29,32) |
| InChIKey | PAVBTZRDUIKYKV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|