C22H26N4O3 — CID 167787833
1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-N-(2,3-dihydro-1-benzofuran-5-yl)piperidine-2-carboxamide (PubChem CID 167787833) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-N-(2,3-dihydro-1-benzofuran-5-yl)piperidine-2-carboxamide.
| Compound Name | 1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-N-(2,3-dihydro-1-benzofuran-5-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 167787833 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-[3-(3-but-3-ynyldiazirin-3-yl)propanoyl]-N-(2,3-dihydro-1-benzofuran-5-yl)piperidine-2-carboxamide |
| SMILES | C#CCCC1(CCC(=O)N2CCCCC2C(=O)Nc2ccc3c(c2)CCO3)N=N1 |
| InChI | InChI=1S/C22H26N4O3/c1-2-3-11-22(24-25-22)12-9-20(27)26-13-5-4-6-18(26)21(28)23-17-7-8-19-16(15-17)10-14-29-19/h1,7-8,15,18H,3-6,9-14H2,(H,23,28) |
| InChIKey | FJIKJTKWOJVMNK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|