C19H22FN5O2 — CID 166416454
2-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-1-N-(4-fluorophenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 166416454) has the molecular formula C19H22FN5O2 and a molecular weight of 371.42 g/mol. Its IUPAC name is 2-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-1-N-(4-fluorophenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-1-N-(4-fluorophenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 166416454 |
| Molecular Formula | C19H22FN5O2 |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 2-N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-1-N-(4-fluorophenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | C#CCCC1(CCNC(=O)C2CCCN2C(=O)Nc2ccc(F)cc2)N=N1 |
| InChI | InChI=1S/C19H22FN5O2/c1-2-3-10-19(23-24-19)11-12-21-17(26)16-5-4-13-25(16)18(27)22-15-8-6-14(20)7-9-15/h1,6-9,16H,3-5,10-13H2,(H,21,26)(H,22,27) |
| InChIKey | RIMYYRNGPIPASP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|