C17H20ClN3OS — CID 16778792
N-(2-amino-5-chlorophenyl)-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butanamide (PubChem CID 16778792) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is N-(2-amino-5-chlorophenyl)-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butanamide.
| Compound Name | N-(2-amino-5-chlorophenyl)-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butanamide |
|---|---|
| PubChem CID | 16778792 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-(2-amino-5-chlorophenyl)-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)butanamide |
| SMILES | Nc1ccc(Cl)cc1NC(=O)CCCN1CCc2sccc2C1 |
| InChI | InChI=1S/C17H20ClN3OS/c18-13-3-4-14(19)15(10-13)20-17(22)2-1-7-21-8-5-16-12(11-21)6-9-23-16/h3-4,6,9-10H,1-2,5,7-8,11,19H2,(H,20,22) |
| InChIKey | MFQCZEYEXOHUDG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|