C17H23N3O7S — CID 167787965
(E)-4-[4-(benzenesulfonyl)piperazin-1-yl]-N-(2,3-dihydroxypropoxy)-4-oxobut-2-enamide (PubChem CID 167787965) has the molecular formula C17H23N3O7S and a molecular weight of 413.45 g/mol. Its IUPAC name is (E)-4-[4-(benzenesulfonyl)piperazin-1-yl]-N-(2,3-dihydroxypropoxy)-4-oxobut-2-enamide.
| Compound Name | (E)-4-[4-(benzenesulfonyl)piperazin-1-yl]-N-(2,3-dihydroxypropoxy)-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 167787965 |
| Molecular Formula | C17H23N3O7S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (E)-4-[4-(benzenesulfonyl)piperazin-1-yl]-N-(2,3-dihydroxypropoxy)-4-oxobut-2-enamide |
| SMILES | O=C(/C=C/C(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1)NOCC(O)CO |
| InChI | InChI=1S/C17H23N3O7S/c21-12-14(22)13-27-18-16(23)6-7-17(24)19-8-10-20(11-9-19)28(25,26)15-4-2-1-3-5-15/h1-7,14,21-22H,8-13H2,(H,18,23)/b7-6+ |
| InChIKey | HFPRILKDXKTPHA-VOTSOKGWSA-N |
| XLogP | -1.52 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|