C10H13ClFN3O — CID 167792308
2-chloro-2-fluoro-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethyl)acetamide (PubChem CID 167792308) has the molecular formula C10H13ClFN3O and a molecular weight of 245.68 g/mol. Its IUPAC name is 2-chloro-2-fluoro-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-chloro-2-fluoro-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 167792308 |
| Molecular Formula | C10H13ClFN3O |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-chloro-2-fluoro-N-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(NCc1cnc2n1CCCC2)C(F)Cl |
| InChI | InChI=1S/C10H13ClFN3O/c11-9(12)10(16)14-6-7-5-13-8-3-1-2-4-15(7)8/h5,9H,1-4,6H2,(H,14,16) |
| InChIKey | BPTNSQJVUIHRPJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|