C22H29N5O2 — CID 167792698
N,5-dimethyl-N-[[1-(3-methylbut-3-enoyl)piperidin-3-yl]methyl]-1-pyridin-2-ylpyrazole-3-carboxamide (PubChem CID 167792698) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N,5-dimethyl-N-[[1-(3-methylbut-3-enoyl)piperidin-3-yl]methyl]-1-pyridin-2-ylpyrazole-3-carboxamide.
| Compound Name | N,5-dimethyl-N-[[1-(3-methylbut-3-enoyl)piperidin-3-yl]methyl]-1-pyridin-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 167792698 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | N,5-dimethyl-N-[[1-(3-methylbut-3-enoyl)piperidin-3-yl]methyl]-1-pyridin-2-ylpyrazole-3-carboxamide |
| SMILES | C=C(C)CC(=O)N1CCCC(CN(C)C(=O)c2cc(C)n(-c3ccccn3)n2)C1 |
| InChI | InChI=1S/C22H29N5O2/c1-16(2)12-21(28)26-11-7-8-18(15-26)14-25(4)22(29)19-13-17(3)27(24-19)20-9-5-6-10-23-20/h5-6,9-10,13,18H,1,7-8,11-12,14-15H2,2-4H3 |
| InChIKey | XFTGJPDGUJBPGT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|