C18H25N3O3 — CID 167793030
1-[[1-(2-methoxyethyl)pyrazol-4-yl]methyl]-5-(3-methoxyphenyl)pyrrolidin-3-ol (PubChem CID 167793030) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[[1-(2-methoxyethyl)pyrazol-4-yl]methyl]-5-(3-methoxyphenyl)pyrrolidin-3-ol.
| Compound Name | 1-[[1-(2-methoxyethyl)pyrazol-4-yl]methyl]-5-(3-methoxyphenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 167793030 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-[[1-(2-methoxyethyl)pyrazol-4-yl]methyl]-5-(3-methoxyphenyl)pyrrolidin-3-ol |
| SMILES | COCCn1cc(CN2CC(O)CC2c2cccc(OC)c2)cn1 |
| InChI | InChI=1S/C18H25N3O3/c1-23-7-6-21-12-14(10-19-21)11-20-13-16(22)9-18(20)15-4-3-5-17(8-15)24-2/h3-5,8,10,12,16,18,22H,6-7,9,11,13H2,1-2H3 |
| InChIKey | VWRVOGXIZLZSII-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |