C21H18F2N6O — CID 167793458
(6-fluoro-1H-indol-2-yl)-[2-[[4-(2-fluoro-4-pyridinyl)triazol-1-yl]methyl]pyrrolidin-1-yl]methanone (PubChem CID 167793458) has the molecular formula C21H18F2N6O and a molecular weight of 408.41 g/mol. Its IUPAC name is (6-fluoro-1H-indol-2-yl)-[2-[[4-(2-fluoro-4-pyridinyl)triazol-1-yl]methyl]pyrrolidin-1-yl]methanone.
| Compound Name | (6-fluoro-1H-indol-2-yl)-[2-[[4-(2-fluoro-4-pyridinyl)triazol-1-yl]methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 167793458 |
| Molecular Formula | C21H18F2N6O |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (6-fluoro-1H-indol-2-yl)-[2-[[4-(2-fluoro-4-pyridinyl)triazol-1-yl]methyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc2ccc(F)cc2[nH]1)N1CCCC1Cn1cc(-c2ccnc(F)c2)nn1 |
| InChI | InChI=1S/C21H18F2N6O/c22-15-4-3-13-8-18(25-17(13)10-15)21(30)29-7-1-2-16(29)11-28-12-19(26-27-28)14-5-6-24-20(23)9-14/h3-6,8-10,12,16,25H,1-2,7,11H2 |
| InChIKey | HUBMEIQGFCBHSX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|