C20H24N2O3 — CID 167793924
4-(2-oxo-2-spiro[2H-indole-3,1'-cyclohexane]-1-ylethyl)piperidine-2,6-dione (PubChem CID 167793924) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-(2-oxo-2-spiro[2H-indole-3,1'-cyclohexane]-1-ylethyl)piperidine-2,6-dione.
| Compound Name | 4-(2-oxo-2-spiro[2H-indole-3,1'-cyclohexane]-1-ylethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167793924 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 4-(2-oxo-2-spiro[2H-indole-3,1'-cyclohexane]-1-ylethyl)piperidine-2,6-dione |
| SMILES | O=C1CC(CC(=O)N2CC3(CCCCC3)c3ccccc32)CC(=O)N1 |
| InChI | InChI=1S/C20H24N2O3/c23-17-10-14(11-18(24)21-17)12-19(25)22-13-20(8-4-1-5-9-20)15-6-2-3-7-16(15)22/h2-3,6-7,14H,1,4-5,8-13H2,(H,21,23,24) |
| InChIKey | DHUOXQKKNZWYGA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|