C17H21N3O3 — CID 167794161
1-[[5-[(2R,3S,3aR,7aR)-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]-1,2,4-oxadiazol-3-yl]methyl]pyridin-2-one (PubChem CID 167794161) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-[[5-[(2R,3S,3aR,7aR)-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]-1,2,4-oxadiazol-3-yl]methyl]pyridin-2-one.
| Compound Name | 1-[[5-[(2R,3S,3aR,7aR)-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]-1,2,4-oxadiazol-3-yl]methyl]pyridin-2-one |
|---|---|
| PubChem CID | 167794161 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1-[[5-[(2R,3S,3aR,7aR)-3-methyl-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl]-1,2,4-oxadiazol-3-yl]methyl]pyridin-2-one |
| SMILES | C[C@H]1[C@H]2CCCC[C@H]2O[C@H]1c1nc(Cn2ccccc2=O)no1 |
| InChI | InChI=1S/C17H21N3O3/c1-11-12-6-2-3-7-13(12)22-16(11)17-18-14(19-23-17)10-20-9-5-4-8-15(20)21/h4-5,8-9,11-13,16H,2-3,6-7,10H2,1H3/t11-,12+,13+,16+/m0/s1 |
| InChIKey | SEIHVDYHXLZBHI-VPWBDBDCSA-N |
| XLogP | 2.55 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |