C19H21ClFN3O2 — CID 167794895
(2-chlorophenyl)-[4-[2-[(3-fluoro-2-pyridinyl)oxy]ethylamino]piperidin-1-yl]methanone (PubChem CID 167794895) has the molecular formula C19H21ClFN3O2 and a molecular weight of 377.85 g/mol. Its IUPAC name is (2-chlorophenyl)-[4-[2-[(3-fluoro-2-pyridinyl)oxy]ethylamino]piperidin-1-yl]methanone.
| Compound Name | (2-chlorophenyl)-[4-[2-[(3-fluoro-2-pyridinyl)oxy]ethylamino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 167794895 |
| Molecular Formula | C19H21ClFN3O2 |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (2-chlorophenyl)-[4-[2-[(3-fluoro-2-pyridinyl)oxy]ethylamino]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1Cl)N1CCC(NCCOc2ncccc2F)CC1 |
| InChI | InChI=1S/C19H21ClFN3O2/c20-16-5-2-1-4-15(16)19(25)24-11-7-14(8-12-24)22-10-13-26-18-17(21)6-3-9-23-18/h1-6,9,14,22H,7-8,10-13H2 |
| InChIKey | JLWBEWSKGDOZNV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|